| Name |
Sclareol |
| Formula |
C20H36O2 |
| Mw |
308.27153039 |
| CAS RN |
515-03-7 |
| C_ID |
C00000894
, 
|
| InChIKey |
XVULBTBTFGYVRC-DAPSGKGNNA-N |
| InChICode |
InChI=1S/C20H36O2/c1-7-18(4,21)13-9-16-19(5)12-8-11-17(2,3)15(19)10-14-20(16,6)22/h7,15-16,21-22H,1,8-14H2,2-6H3/t15-,16+,18-,19-,20+/m0/s1 |
| SMILES |
C=C[C@](C)(O)CC[C@@H]1[C@@]2(C)CCCC(C)(C)[C@@H]2CC[C@@]1(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caryophyllaceae | Stellaria pallida | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Fabaceae | Acacia sp. | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia reuterana | Ref. |
| Plantae | Labiatae | Salvia sclarea  | Ref. |
| Plantae | Polemoniaceae | Polemonium viscosum | Ref. |
| Plantae | Solanaceae | Nicotiana glutinosa | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
|
|
zoom in
| Organism | Salvia reuterana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|