| Name |
Termilignan |
| Formula |
C19H20O3 |
| Mw |
296.1412445 |
| CAS RN |
192220-05-6 |
| C_ID |
C00000656
, 
|
| InChIKey |
JFMRBOFPBJLBBF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H20O3/c1-13(10-15-4-7-17(20)8-5-15)14(2)11-16-6-9-18(22-3)12-19(16)21/h4-9,12,20-21H,1-2,10-11H2,3H3 |
| SMILES |
C=C(Cc1ccc(O)cc1)C(=C)Cc1ccc(OC)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Combretaceae | Terminalia bellerica  | Ref. |
| Plantae | Combretaceae | Terminalia bellirica  | Ref. |
| Plantae | Combretaceae | Terminalia chebula var.tomentella  | Ref. |
| Plantae | Combretaceae | Terminalia sericea  | Ref. |
| Plantae | Combretaceae | Terminalia superb | Ref. |
| - | - | Terminalis bellerica | Ref. |
|
|
zoom in
| Organism | Terminalia superb | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|