| Name |
Rhodioloside (-)-Rhodioloside Salidroside Tyrosol alpha-(beta-D-glucopyranoside) |
| Formula |
C14H20O7 |
| Mw |
300.12090299 |
| CAS RN |
10338-51-9 |
| C_ID |
C00031274
, 
|
| InChIKey |
ILRCGYURZSFMEG-UWSPHAEVNA-N |
| InChICode |
InChI=1S/C14H20O7/c15-7-10-11(17)12(18)13(19)14(21-10)20-6-5-8-1-3-9(16)4-2-8/h1-4,10-19H,5-7H2/t10-,11-,12+,13-,14-/m1/s1 |
| SMILES |
OC[C@H]1O[C@@H](OCCc2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Asystasia gangetica L.  | Ref. |
| Plantae | Bignoniaceae | Fernandoa adenophylla | Ref. |
| Plantae | Convallariaceae | Rohdea juparensis | Ref. |
| Plantae | Convallariaceae | Rohdea jyunnanensis | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata (HOOK.f.et Thoms.) H.OHBA | Ref. |
| Plantae | Crassulaceae | Rhodiola kirilowii | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Euphorbiaceae | Croton chilensis | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
| Plantae | Labiatae | Clerodendrum inerme  | Ref. |
| Plantae | Labiatae | Perovskia scrophularifolia | Ref. |
| Plantae | Labiatae | Phlomis spinidens | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
| Plantae | Longaniaceae | Strychnos nux-vomica  | Ref. |
| Plantae | Oleaceae | Fraxinus excelsior  | Ref. |
| Plantae | Oleaceae | Ligustrum lucidum  | Ref. |
| Plantae | Oleaceae | Phillyrea latifolia  | Ref. |
| Plantae | Piperaceae | Peperomia sui | Ref. |
| Plantae | Plantaginaceae | Isoplexis chalcantha | Ref. |
| Plantae | Plantaginaceae | Isoplexis sceptrum | Ref. |
| Plantae | Plantaginaceae | Plantago australis | Ref. |
| Plantae | Plantaginaceae | Plantago coronopus  | Ref. |
| Plantae | Plantaginaceae | Veronica beccabunga  | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
| Plantae | Salicaceae | Salix triandra | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia amplexicaulis | Ref. |
| - | - | Rodiola algida | Ref. |
| - | - | Rodiola coccinea | Ref. |
| - | - | Rodiola crenulata | Ref. |
| - | - | Rodiola himalansis | Ref. |
| - | - | Rodiola kirilowii | Ref. |
| - | - | Rodiola quadrifida | Ref. |
| - | - | Rodiola sacra | Ref. |
| - | - | Rodiola subopposita | Ref. |
|
|
zoom in
| Organism | Rodiola quadrifida | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Wang, et al., APS, 27, (1992), 117.
Peng, et al., CCMM, 19, (1994), 676.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Calixto, et al., Planta Med, 69, (2003), 973.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|