| Name |
Nerolidol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
142-50-7 |
| C_ID |
C00003166
, 
|
| InChIKey |
FQTLCLSUCSAZDY-JAIKHUDFNA-N |
| InChICode |
InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11+/t15-/m1/s1 |
| SMILES |
C=C[C@@](C)(O)CC/C=C(C)CCC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Elephantidae | Loxodonta africana  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Geigeria ornativa | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Fabaceae | Myroxylon pereirae  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Oleaceae | Jasminum multiflorum  | Ref. |
| Plantae | Oleaceae | Jasminum sambac  | Ref. |
| Plantae | Pinaceae | Pseudotsuga wilsoniana | Ref. |
| Plantae | Piperaceae | Piper aduncum  | Ref. |
| Plantae | Piperaceae | Piper falconeri | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rosaceae | Prunus armeniaca L. (K604-19,K113-40,K33-81)  | Ref. |
| Plantae | Rosaceae | Prunus salcina Lindl. (Blackamber,Friar) | Ref. |
| Plantae | Rosaceae | Prunus salcina Lindl. (Friar) | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus grandis  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansi  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Aframomum pruinosum | Ref. |
| Plantae | Zingiberaceae | Aframomum zambesiacum (Baker) K.Schum.  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Laurencia dendroidea | Ref. |
|
|
zoom in
| Organism | Valeriana officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|