| Name |
Pimpinellin |
| Formula |
C13H10O5 |
| Mw |
246.05282343 |
| CAS RN |
131-12-4 |
| C_ID |
C00002493
, 
|
| InChIKey |
BQPRWZCEKZLBHL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H10O5/c1-15-11-7-3-4-9(14)18-10(7)8-5-6-17-12(8)13(11)16-2/h3-6H,1-2H3 |
| SMILES |
COc1c(OC)c2occc2c2oc(=O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica genuflexa | Ref. |
| Plantae | Apiaceae | Heracleum asperum | Ref. |
| Plantae | Apiaceae | Heracleum candicans WALL.  | Ref. |
| Plantae | Apiaceae | Heracleum dissectum | Ref. |
| Plantae | Apiaceae | Heracleum grandiflorum | Ref. |
| Plantae | Apiaceae | Heracleum lehmannianum | Ref. |
| Plantae | Apiaceae | Heracleum moellendoeffii | Ref. |
| Plantae | Apiaceae | Heracleum moellendorffii Hance | Ref. |
| Plantae | Apiaceae | Heracleum moellendorffii Hance var.paucivitatum | Ref. |
| Plantae | Apiaceae | Heracleum ponticum | Ref. |
| Plantae | Apiaceae | Heracleum scabridum | Ref. |
| Plantae | Apiaceae | Heracleum sphondylium  | Ref. |
| Plantae | Apiaceae | Heracleum spp. | Ref. |
| Plantae | Apiaceae | Heracleum woroschiklowii | Ref. |
| Plantae | Apiaceae | Heracleum yungningense | Ref. |
| Plantae | Apiaceae | Peucedanum govanianum var.bicolo | Ref. |
| Plantae | Apiaceae | Pimpinella magna | Ref. |
| Plantae | Apiaceae | Pimpinella saxifraga  | Ref. |
| Plantae | Apocynaceae | Alstonia moirei | Ref. |
| Plantae | Asteraceae | Artemisia canariensis | Ref. |
| Plantae | Cyperaceae | Cyperus papyrus  | Ref. |
| Plantae | Moraceae | Dorstenia asaroides | Ref. |
| Plantae | Moraceae | Dorstenia bahiensis | Ref. |
| Plantae | Moraceae | Dorstenia barnimiana | Ref. |
| Plantae | Moraceae | Dorstenia brasiliensis  | Ref. |
| Plantae | Moraceae | Dorstenia bryonifolia | Ref. |
| Plantae | Moraceae | Dorstenia cayapiaa | Ref. |
| Plantae | Moraceae | Dorstenia contrajerva  | Ref. |
| Plantae | Moraceae | Dorstenia drakena  | Ref. |
| Plantae | Moraceae | Dorstenia excentria | Ref. |
| Plantae | Moraceae | Dorstenia heringerii | Ref. |
| Plantae | Moraceae | Dorstenia lindeniana | Ref. |
| Plantae | Moraceae | Dorstenia psilurus | Ref. |
| Plantae | Rutaceae | Clausena anisata  | Ref. |
| Plantae | Rutaceae | Toddalia asiatica  | Ref. |
| Plantae | Thymelaeaceae | Stellera chamaejasme  | Ref. |
| - | - | Archangelica brevicaulis | Ref. |
|
|
zoom in
| Organism | Archangelica brevicaulis | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Rao, et al., CCMM, 18, (1993), 681.
Rao, et al., CCMM, 20, (1995), 740.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|