| Name |
(+)-Isotetrandrine Isotetrandrine Isosinomenin A Isosinomenine A O,O'-Dimethylobamegine O,O'-Dimethylstepholine O,O-Dimethylobamegine O,O-Dimethylstepholine O-Methylberbamine |
| Formula |
C38H42N2O6 |
| Mw |
622.30428709 |
| CAS RN |
477-57-6 |
| C_ID |
C00025266
, 
|
| InChIKey |
WTXHFWYAETTXNF-SPFVONBBNA-N |
| InChICode |
InChI=1S/C38H42N2O6/c1-39-14-12-25-20-32(42-4)34-22-28(25)29(39)17-23-8-7-9-27(16-23)45-33-19-24(10-11-31(33)41-3)18-30-36-26(13-15-40(30)2)21-35(43-5)37(44-6)38(36)46-34/h7-11,16,19-22,29-30H,12-15,17-18H2,1-6H3/t29-,30+/m0/s1 |
| SMILES |
COc1ccc2cc1Oc1cccc(c1)C[C@H]1c3cc(c(OC)cc3CCN1C)Oc1c(OC)c(OC)cc3c1[C@@H](C2)N(C)CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia columbiana | Ref. |
| Plantae | Berberidaceae | Berberis aemulans | Ref. |
| Plantae | Berberidaceae | Berberis brandisiana | Ref. |
| Plantae | Berberidaceae | Berberis candidula | Ref. |
| Plantae | Berberidaceae | Berberis crataegina  | Ref. |
| Plantae | Berberidaceae | Berberis glauca  | Ref. |
| Plantae | Berberidaceae | Berberis japonica | Ref. |
| Plantae | Berberidaceae | Berberis poirettii | Ref. |
| Plantae | Berberidaceae | Berberis sibirica  | Ref. |
| Plantae | Berberidaceae | Berberis thunbergii  | Ref. |
| Plantae | Berberidaceae | Berberis vulgaris  | Ref. |
| Plantae | Berberidaceae | Berberis vulgaris ssp.australis  | Ref. |
| Plantae | Berberidaceae | Mahonia japonica | Ref. |
| Plantae | Berberidaceae | Mahonia siamensis Takeda(stem bark) | Ref. |
| Plantae | Menispermaceae | Cocculus laurifolius DC. | Ref. |
| Plantae | Menispermaceae | Cyclea barbata Miers  | Ref. |
| Plantae | Menispermaceae | Limaciopsis loangensis Engl. | Ref. |
| Plantae | Menispermaceae | Pycnarrhena australiana Muell. | Ref. |
| Plantae | Menispermaceae | Pycnarrhena manillensis Vidal | Ref. |
| Plantae | Menispermaceae | Sinomenium diversifolium Diels | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha  | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha Hayata  | Ref. |
| Plantae | Menispermaceae | Stephania delavayi Diels | Ref. |
| Plantae | Menispermaceae | Stephania dicentrinifera H.S.Lo & M.Yang | Ref. |
| Plantae | Menispermaceae | Stephania dielsiana Y.C.Wu | Ref. |
| Plantae | Menispermaceae | Stephania elegans Hook.& Thoms. | Ref. |
| Plantae | Menispermaceae | Stephania erecta Craib. | Ref. |
| Plantae | Menispermaceae | Stephania hainanensis H.S.Lo & Y. | Ref. |
| Plantae | Menispermaceae | Stephania pierii | Ref. |
| Plantae | Menispermaceae | Stephania pierrei Diels  | Ref. |
| Plantae | Menispermaceae | Tiliacora funifera Engl.ex Diels | Ref. |
| Plantae | Menispermaceae | Triclisia gilletii (De Wild.) Staner  | Ref. |
| Plantae | Monimiaceae | Laurelia sempervirens | Ref. |
| Plantae | Ranunculaceae | Thalictrum atriplex | Ref. |
| Plantae | Ranunculaceae | Thalictrum faberi | Ref. |
| Plantae | Ranunculaceae | Thalictrum foetidum  | Ref. |
| Plantae | Ranunculaceae | Thalictrum foliolosum  | Ref. |
| Plantae | Ranunculaceae | Thalictrum glandulosissimum | Ref. |
| Plantae | Ranunculaceae | Thalictrum microgynum | Ref. |
| Plantae | Ranunculaceae | Thalictrum petaloideum | Ref. |
| Plantae | Ranunculaceae | Thalictrum simplex | Ref. |
| Plantae | Ranunculaceae | Thalictrum thunbergii | Ref. |
|
|
zoom in
| Organism | Thalictrum foetidum | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|