| Name |
Tricin 5,7,4'-Trihydroxy-3',5'-dimethoxyflavone 5,7-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
520-32-1 |
| C_ID |
C00013329
, 
|
| InChIKey |
HRGUSFBJBOKSML-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)17(14)21)12-7-11(20)16-10(19)5-9(18)6-13(16)24-12/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Asteraceae | Artemisia minor | Ref. |
| Plantae | Berberidaceae | Epimedium acuminatum | Ref. |
| Plantae | Berberidaceae | Epimedium brevicornum  | Ref. |
| Plantae | Berberidaceae | Epimedium koreanum  | Ref. |
| Plantae | Bromeliaceae | Aechmea glomerata | Ref. |
| Plantae | Connaraceae | Agelaea pentagyna  | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes rosthornii  | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Fabaceae | Hymenaea palustris Ducke | Ref. |
| Plantae | Fabaceae | Lespedeza virgata | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Iridaceae | Crocus aureus | Ref. |
| Plantae | Iridaceae | Crocus heuffelianus | Ref. |
| Plantae | Iridaceae | Crocus laevigatus | Ref. |
| Plantae | Labiatae | Leucas cephalotes SPRENG.  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Myoporaceae | Myoporum bontioides | Ref. |
| Plantae | Orobanchaceae | Castilleja fissifolia | Ref. |
| Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
| Plantae | Palmae | Phoenix canariensis  | Ref. |
| Plantae | Poaceae | Gynerium sagittatum  | Ref. |
| Plantae | Poaceae | Miscanthus sinensis | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Phragmites communis  | Ref. |
| Plantae | Poaceae | Spartina cynosuroides | Ref. |
| Plantae | Ranunculaceae | Ranunculus japonicus | Ref. |
| Plantae | Smilacaceae | Smilax bracteata | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia indica  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
| Plantae | Velloziaceae | Xerophyta retinervis  | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|