| Name |
Quercetin 7,3'-dimethyl ether Rhamnazin 3,4',5-Trihydroxy-3',7-dimethoxyflavone 7,3'-Di-O-methylquercetin 3,5-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
552-54-5 |
| C_ID |
C00004642
, 
|
| InChIKey |
MYMGKIQXYXSRIJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-10(18)12(5-8)23-2/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Artemisia campestris  | Ref. |
| Plantae | Asteraceae | Grindelia nana | Ref. |
| Plantae | Asteraceae | Heterotheca villosa | Ref. |
| Plantae | Asteraceae | Madia elegans | Ref. |
| Plantae | Asteraceae | Stevia subpubescens | Ref. |
| Plantae | Asteraceae | Wedelia biflora  | Ref. |
| Plantae | Boraginaceae | Heliotropium stenophyllum | Ref. |
| Plantae | Capparaceae | Capparis tweediana  | Ref. |
| Plantae | Cistaceae | Cistus spp. | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bracteata | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Crassulaceae | Aeonium spp. | Ref. |
| Plantae | Cunoniaceae | Eucryphia jinksii | Ref. |
| Plantae | Dilleniaceae | Dillenia indica  | Ref. |
| Plantae | Escalloniaceae | Escallonia pulverulenta | Ref. |
| Plantae | Geraniaceae | Geranium macrorrhizum  | Ref. |
| Plantae | Labiatae | Orthosiphon spicatus | Ref. |
| Plantae | Malvaceae | Kitaibela vitifolia | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus cunninghamii | Ref. |
| Plantae | Nyctaginaceae | Mirabilis viscosa | Ref. |
| Plantae | Passifloraceae | Passiflora palmeri | Ref. |
| Plantae | Polygonaceae | Polygonum polystachyum | Ref. |
| Plantae | Polygonaceae | Polygonum punctatum  | Ref. |
| Plantae | Pteridaceae | Notholaena nivea | Ref. |
| Plantae | Rhamnaceae | Rhamnus alaternus  | Ref. |
| Plantae | Rhamnaceae | Rhamnus cathartica  | Ref. |
| Plantae | Rhamnaceae | Rhamnus catharticus  | Ref. |
| Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
| Plantae | Rhamnaceae | Rhamnus prinoides  | Ref. |
| Plantae | Rhamnaceae | Rhamnus saxatilis | Ref. |
| Plantae | Santalaceae | Viscum cruciatum  | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Solanaceae | Salpiglossis sinuata | Ref. |
| Plantae | Zygophyllaceae | Larrea cuneifolia  | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
| - | - | Siegesbeckia jorullensis | Ref. |
|
|
zoom in
| Organism | Aesculus hippocastanum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Perkin,J.Chem.Soc.,67,(1895),500
Perkin,J.Chem.Soc.,81,(1902),469 |
|---|
|