| Name |
Kaempferitrin Kaempferol 3,7-di-O-rhamnoside Kaempferol 3,7-di-O-alpha-rhamnopyranoside Kaempferol 3,7-dirhamnoside |
| Formula |
C27H30O14 |
| Mw |
578.16355567 |
| CAS RN |
482-38-2 |
| C_ID |
C00005189
, 
|
| InChIKey |
PUPKKEQDLNREIM-SIHGUETHNA-N |
| InChICode |
InChI=1S/C27H30O14/c1-9-17(30)20(33)22(35)26(37-9)39-13-7-14(29)16-15(8-13)40-24(11-3-5-12(28)6-4-11)25(19(16)32)41-27-23(36)21(34)18(31)10(2)38-27/h3-10,17-18,20-23,26-31,33-36H,1-2H3/t9-,10-,17-,18-,20-,21+,22-,23-,26-,27-/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O[C@@H]4OC(C)[C@H](O)[C@H](O)C4O)cc(O)c3c2=O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Apiaceae | Eryngium planum  | Ref. |
| Plantae | Aspleniaceae | Asplenium bulbiferum  | Ref. |
| Plantae | Aspleniaceae | Asplenium trichomanes  | Ref. |
| Plantae | Asteraceae | Clibadium pilonicum | Ref. |
| Plantae | Asteraceae | Clibadium surinamense  | Ref. |
| Plantae | Asteraceae | Eupatorium hookerianum | Ref. |
| Plantae | Asteraceae | Liatris spp. | Ref. |
| Plantae | Asteraceae | Tagetes erecta  | Ref. |
| Plantae | Berberidaceae | Epimedium acuminatum | Ref. |
| Plantae | Berberidaceae | Epimedium brevicornum  | Ref. |
| Plantae | Berberidaceae | Epimedium sutchuenense | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Celastraceae | Celastrus hypoleucus | Ref. |
| Plantae | Chenopodiaceae | Chenopodium murale  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Crassulaceae | Sedum telephium  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Siraitia grosvenori | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes cucumeroides  | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum cuneifolium | Ref. |
| Plantae | Fabaceae | Acacia mangium  | Ref. |
| Plantae | Fabaceae | Desmodium podocarpum | Ref. |
| Plantae | Fabaceae | Desmodium racemosum | Ref. |
| Plantae | Fabaceae | Dorycnium graecum | Ref. |
| Plantae | Fabaceae | Dorycnium pentaphyllum | Ref. |
| Plantae | Fabaceae | Indigofera arrecta  | Ref. |
| Plantae | Fabaceae | Lathyrus spp. | Ref. |
| Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Fabaceae | Lotus japonicus | Ref. |
| Plantae | Geraniaceae | Geranium nepalense  | Ref. |
| Plantae | Hymenophytaceae | Hymenophyton leptopodum | Ref. |
| Plantae | Lauraceae | Cinnamomum sieboldii  | Ref. |
| Plantae | Malvaceae | Hibiscus cannabinus  | Ref. |
| Plantae | Malvaceae | Tilia alburnum | Ref. |
| Plantae | Moraceae | Ficus septica | Ref. |
| Plantae | Myrsinaceae | Ardisia colorata | Ref. |
| Plantae | Myrsinaceae | Lysimachia christinae  | Ref. |
| Plantae | Oleaceae | Ligustrum nilghirense | Ref. |
| Plantae | Piperaceae | Piper umbellatum  | Ref. |
| Plantae | Rosaceae | Prunus japonica  | Ref. |
| Plantae | Solanaceae | Solanum laciniatum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
| Organism | Lotus corniculatus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Perkin,J.Chem.Soc.,91,(1907),435
Hattori,Proc.Imp.Acad.(Tokyo),16,(1940),9 |
|---|
|