| Name |
5,7,4'-Trihydroxy-3,6-dimethoxyflavone 6-Methoxykaempferol 3-methyl ether 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3,6-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
22697-65-0 |
| C_ID |
C00004596
, 
|
| InChIKey |
DDNPCXHBFYJXBJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-16-10(19)7-11-12(13(16)20)14(21)17(23-2)15(24-11)8-3-5-9(18)6-4-8/h3-7,18-20H,1-2H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccc(O)cc3)c(OC)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea micrantha | Ref. |
| Plantae | Asteraceae | Ageratina espinosara | Ref. |
| Plantae | Asteraceae | Ageratina havanensis | Ref. |
| Plantae | Asteraceae | Ambrosia chamissonis | Ref. |
| Plantae | Asteraceae | Brickellia eupatorioides | Ref. |
| Plantae | Asteraceae | Brickellia scoparia | Ref. |
| Plantae | Asteraceae | Calycadenia multiglandulosa | Ref. |
| Plantae | Asteraceae | Calycadenia villosa | Ref. |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Asteraceae | Centaurea spp. | Ref. |
| Plantae | Asteraceae | Eupatorium altissimum | Ref. |
| Plantae | Asteraceae | Flourensia cernua | Ref. |
| Plantae | Asteraceae | Gonospermum fruticosum | Ref. |
| Plantae | Asteraceae | Gonospermum gomerae | Ref. |
| Plantae | Asteraceae | Grindelia robusta | Ref. |
| Plantae | Asteraceae | Grindelia squarrosa | Ref. |
| Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
| Plantae | Asteraceae | Heteranthemis viscidehirta | Ref. |
| Plantae | Asteraceae | Heterotheca villosa | Ref. |
| Plantae | Asteraceae | Oncosiphon grandiflorum | Ref. |
| Plantae | Asteraceae | Perityle lemmonii | Ref. |
| Plantae | Asteraceae | Psiadia dentata | Ref. |
| Plantae | Asteraceae | Stevia berlandieri | Ref. |
| Plantae | Asteraceae | Tanacetum parthenium  | Ref. |
| Plantae | Betulaceae | Alnus glutinosa  | Ref. |
| Plantae | Boraginaceae | Alkanna orientalis | Ref. |
| Plantae | Cistaceae | Cistus albanicus | Ref. |
| Plantae | Crassulaceae | Aeonium spp. | Ref. |
| Plantae | Labiatae | Salvia cyanescens | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Gardenia spp.  | Ref. |
| Plantae | Sapindaceae | Dodonaea viscosa  | Ref. |
| Plantae | Velloziaceae | Barbacenia rubro-virens | Ref. |
|
|
zoom in
| Organism | Dodonaea viscosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Rosler,Phytochem.,10,(1971),450
Wollenweber,Z.Naturforsch.B.,26,(1971),1188 |
|---|
|