| Name |
Hesperidin |
| Formula |
C28H34O15 |
| Mw |
610.18977042 |
| CAS RN |
520-26-3 |
| C_ID |
C00000970
, 
|
| InChIKey |
QUQPHWDTPGMPEX-IGGWMNTDNA-N |
| InChICode |
InChI=1S/C28H34O15/c1-10-21(32)23(34)25(36)27(40-10)39-9-19-22(33)24(35)26(37)28(43-19)41-12-6-14(30)20-15(31)8-17(42-18(20)7-12)11-3-4-16(38-2)13(29)5-11/h3-7,10,17,19,21-30,32-37H,8-9H2,1-2H3/t10-,17-,19-,21-,22+,23+,24-,25-,26+,27+,28+/m0/s1 |
| SMILES |
COc1ccc([C@@H]2CC(=O)c3c(O)cc(O[C@@H]4OC(CO[C@@H]5OC(C)[C@H](O)C(O)[C@@H]5O)[C@@H](O)[C@H](O)C4O)cc3O2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Asteraceae | Baccharis magellanica | Ref. |
| Plantae | Asteraceae | Vernonia spp. | Ref. |
| Plantae | Caricaceae | Carica papaya | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia | Ref. |
| Plantae | Ephedraceae | Ephedra sinica | Ref. |
| Plantae | Fagaceae | Castanea sativa | Ref. |
| Plantae | Labiatae | Hyssopus spp. | Ref. |
| Plantae | Labiatae | Mentha longifolia | Ref. |
| Plantae | Labiatae | Mentha spp. | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis | Ref. |
| Plantae | Lythraceae | Punica granatum | Ref. |
| Plantae | Moraceae | Ficus beecheyana | Ref. |
| Plantae | Myrtaceae | Myrtus communis | Ref. |
| Plantae | Rutaceae | Citrus aurantium L. var. amara | Ref. |
| Plantae | Rutaceae | Citrus limon | Ref. |
| Plantae | Rutaceae | Citrus natsudaidai | Ref. |
| Plantae | Rutaceae | Citrus paradisi | Ref. |
| Plantae | Rutaceae | Citrus reticulata | Ref. |
| Plantae | Rutaceae | Citrus sinensis | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Citrus sudachi | Ref. |
| Plantae | Rutaceae | Citrus unshiu Markovich | Ref. |
| Plantae | Rutaceae | Esenbeckia yaxhoob Lundell | Ref. |
| Plantae | Rutaceae | Flindersia laevicarpa C.T.White et Francis. | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata | Ref. |
| Plantae | Rutaceae | Zanthoxylum dipetalum | Ref. |
| Plantae | Solanaceae | Capsicum annuum | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Turneraceae | Turnera ulmifolia | Ref. |
| Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
| Plantae | Verbenaceae | Verbena hybrida | Ref. |
| - | - | Rutaceae | Ref. |
|
|
zoom in
| Organism | Turnera ulmifolia |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
