| Name |
8-C-Glucosyl-7-O-methyl-(S)-aloesol |
| Formula |
C20H26O9 |
| Mw |
410.15768243 |
| CAS RN |
135048-11-2 |
| C_ID |
C00063814
|
| InChIKey |
RNWHJIWNYIOZFG-XWPDFOKKSA-N |
| InChICode |
InChI=1S/C20H26O9/c1-8-4-12(27-3)15(20-18(26)17(25)16(24)13(7-21)29-20)19-14(8)11(23)6-10(28-19)5-9(2)22/h4,6,9,13,16-18,20-22,24-26H,5,7H2,1-3H3/t9-,13+,16+,17-,18+,20-/m0/s1 |
| SMILES |
COc1cc(C)c2c(=O)cc(CC(C)O)oc2c1C1OC(CO)C(O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe arborescens  | Ref. |
| Plantae | Asphodelaceae | Aloe marlothii  | Ref. |
| Plantae | Asphodelaceae | Aloe striata | Ref. |
| Plantae | Asphodelaceae | Aloe vera var. chinensis  | Ref. |
|
|
zoom in
| Organism | Aloe vera var. chinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|