| Name |
6-Hydroxyapoatropine |
| Formula |
C17H21NO3 |
| Mw |
287.15214354 |
| CAS RN |
131899-21-3 |
| C_ID |
C00063791
|
| InChIKey |
IZVZMPYXRCTCEG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H21NO3/c1-11(12-6-4-3-5-7-12)17(20)21-14-8-13-9-16(19)15(10-14)18(13)2/h3-7,13-16,19H,1,8-10H2,2H3 |
| SMILES |
C=C(C(=O)OC1CC2CC(O)C(C1)N2C)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Hyoscyamus albus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
|
|
zoom in
| Organism | Hyoscyamus muticus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|