| Name |
alpha-Terpinenyl acetate Terpinene-4-acetate |
| Formula |
C12H20O2 |
| Mw |
196.14632988 |
| CAS RN |
4821-04-9 |
| C_ID |
C00058860
|
| InChIKey |
BFCBRSFYYLSTAA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H20O2/c1-9(2)12(14-11(4)13)7-5-10(3)6-8-12/h5,9H,6-8H2,1-4H3 |
| SMILES |
CC(=O)OC1(C(C)C)CC=C(C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Salvia hydrangea | Ref. |
| Plantae | Labiatae | Salvia mirzayanii | Ref. |
| Plantae | Labiatae | Salvia santolinifolia | Ref. |
|
|
zoom in
| Organism | Salvia santolinifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|