| Name |
Vitisinol E |
| Formula |
C29H26O7 |
| Mw |
486.16785319 |
| CAS RN |
1022106-23-5 |
| C_ID |
C00057745
|
| InChIKey |
NJKMFUYYGNGQBI-VWIBZWLUSA-N |
| InChICode |
InChI=1S/C29H26O7/c1-36-29(35)28-19(5-2-17-3-8-21(30)9-4-17)12-25(34)16-26(18-6-10-22(31)11-7-18)27(28)20-13-23(32)15-24(33)14-20/h2-15,26-28,30-33H,16H2,1H3/b5-2+/t26-,27-,28+/m1/s1 |
| SMILES |
COC(=O)[C@H]1C(/C=C/c2ccc(O)cc2)=CC(=O)C[C@H](c2ccc(O)cc2)[C@H]1c1cc(O)cc(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis betulifolia | Ref. |
| Plantae | Vitaceae | Vitis chunganensis | Ref. |
| Plantae | Vitaceae | Vitis coignetiae  | Ref. |
| Plantae | Vitaceae | Vitis heyneana | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Vitis coignetiae | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|