| Name |
2-(3,4-Dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxy-1-benzopyrylium(1+) Petunidin |
| Formula |
C16H13O7 |
| Mw |
317.06612777 |
| CAS RN |
13270-60-5 |
| C_ID |
C00056076
|
| InChIKey |
AFOLOMGWVXKIQL-UHFFFAOYSA-O |
| InChICode |
InChI=1S/C16H12O7/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16/h2-6H,1H3,(H4-,17,18,19,20,21)/p+1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O)cc(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Ericaceae | Vaccinium myrtillus  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Malvaceae | Malva sylvestris  | Ref. |
| Plantae | Passifloraceae | Passiflora quadrangularis  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum subsp. Andigena  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana spryginii | Ref. |
| - | - | Amonum subulatum | Ref. |
|
|
zoom in
| Organism | Malva sylvestris | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|