| Name |
Caftaric acid |
| Formula |
C13H12O9 |
| Mw |
312.04813198 |
| CAS RN |
67879-58-7 |
| C_ID |
C00055750
|
| InChIKey |
SWGKAHCIOQPKFW-JTNORFRNSA-N |
| InChICode |
InChI=1S/C13H12O9/c14-7-3-1-6(5-8(7)15)2-4-9(16)22-11(13(20)21)10(17)12(18)19/h1-5,10-11,14-15,17H,(H,18,19)(H,20,21)/b4-2+/t10-,11-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H](C(=O)O)[C@@H](O)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Cymodoceaceae | Syringodium filiforme | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Labiatae | Thymus comosus | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
|
|
zoom in
| Organism | Fumaria capreolata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|