| Name |
Benthaphenone Diphenylmethanone Benzophenone |
| Formula |
C13H10O |
| Mw |
182.07316494 |
| CAS RN |
119-61-9 |
| C_ID |
C00055728
|
| InChIKey |
RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| SMILES |
O=C(c1ccccc1)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia benthami | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
|
|
zoom in
| Organism | Lawsonia inermis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|