| Name |
2-Phenylpropane Cumene |
| Formula |
C9H12 |
| Mw |
120.09390038 |
| CAS RN |
98-82-8 |
| C_ID |
C00053958
|
| InChIKey |
RWGFKTVRMDUZSP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| SMILES |
CC(C)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Aldrich Library of 13C and 1H FT NMR Spectra,1992, 2, 2B (nmr) |
|---|
|