| Name |
Caffeoyl alcohol |
| Formula |
C9H10O3 |
| Mw |
166.06299419 |
| CAS RN |
3598-26-3 |
| C_ID |
C00053066
|
| InChIKey |
ZCKDCRKBURQZPT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H10O3/c10-5-1-2-7-3-4-8(11)9(12)6-7/h1-4,6,10-12H,5H2 |
| SMILES |
OC/C=C/c1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aquifoliaceae | Ilex paraguariensis  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
|
|
zoom in
| Organism | Lawsonia inermis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|