| Name |
Bayogenin |
| Formula |
C30H48O5 |
| Mw |
488.35017464 |
| CAS RN |
6989-24-8 |
| C_ID |
C00052866
|
| InChIKey |
RWNHLTKFBKYDOJ-JEERONPWSA-N |
| InChICode |
InChI=1S/C30H48O5/c1-25(2)11-13-30(24(34)35)14-12-28(5)18(19(30)15-25)7-8-22-26(3)16-20(32)23(33)27(4,17-31)21(26)9-10-29(22,28)6/h7,19-23,31-33H,8-17H2,1-6H3,(H,34,35)/t19-,20-,21+,22+,23-,26-,27-,28+,29+,30-/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@H](O)[C@H](O)[C@@](C)(CO)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago arborea | Ref. |
| Plantae | Fabaceae | Medicago hybrida | Ref. |
| Plantae | Fabaceae | Medicago polymorpha  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
|
|
zoom in
| Organism | Medicago polymorpha | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|