| Name |
Methyl phenyl acetate Methyl phenylacetate |
| Formula |
C9H10O2 |
| Mw |
150.06807956 |
| CAS RN |
101-41-7 |
| C_ID |
C00051576
|
| InChIKey |
CRZQGDNQQAALAY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H10O2/c1-11-9(10)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| SMILES |
COC(=O)Cc1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Mycobacteriaceae | Mycobacterium bovis | Ref. |
| Bacteria | Mycobacteriaceae | Mycobacterium tuberculosis | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Ligusticum chuanxiong  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
|
|
zoom in
| Organism | Ligusticum chuanxiong | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|