| Name |
Methyl isobutyl ketone 4-methyl-2-pentanone |
| Formula |
C6H12O |
| Mw |
100.08881501 |
| CAS RN |
108-10-1 |
| C_ID |
C00051562
|
| InChIKey |
NTIZESTWPVYFNL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3 |
| SMILES |
CC(=O)CC(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Alphinia galanga | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|