| Name |
Kadsuranin (+)-Gomisin N |
| Formula |
C23H28O6 |
| Mw |
400.18858863 |
| CAS RN |
713102-92-2 |
| C_ID |
C00051109
|
| InChIKey |
RTZKSTLPRTWFEV-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C23H28O6/c1-12-7-14-9-16(24-3)20(25-4)22(26-5)18(14)19-15(8-13(12)2)10-17-21(23(19)27-6)29-11-28-17/h9-10,12-13H,7-8,11H2,1-6H3 |
| SMILES |
COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)OCO3)CC(C)C(C)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Schisandraceae | Kadsura coccinea | Ref. |
| Plantae | Schisandraceae | Kadsura japonica  | Ref. |
| Plantae | Schisandraceae | Kadsura peltigera | Ref. |
| Plantae | Schisandraceae | Schisandra rubriflora | Ref. |
|
|
zoom in
| Organism | Schisandra rubriflora | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Li, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 28, (2003), 1120 |
|---|
|