| Name |
Isopicropodophyllone |
| Formula |
C22H20O8 |
| Mw |
412.11581762 |
| CAS RN |
55515-07-6 |
| C_ID |
C00050979
|
| InChIKey |
ISCQYPPCSYRZOT-IDJWPUQDNA-N |
| InChICode |
InChI=1S/C22H20O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-19H,8-9H2,1-3H3/t13-,18-,19+/m1/s1 |
| SMILES |
COc1cc([C@@H]2c3cc4c(cc3C(=O)[C@@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Diphylleia sinensis | Ref. |
| Plantae | Berberidaceae | Dysosma pleiantha | Ref. |
| Plantae | Berberidaceae | Podophyllum hexandrum  | Ref. |
| Plantae | Berberidaceae | Podophyllum peltatum  | Ref. |
|
|
zoom in
| Organism | Podophyllum peltatum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|