| Name |
beta,beta-Dimethylacrylshikonin (+)-beta,beta-Dimethylacrylshikonin |
| Formula |
C21H22O6 |
| Mw |
370.14163844 |
| CAS RN |
24502-79-2 |
| C_ID |
C00050542
|
| InChIKey |
BATBOVZTQBLKIL-QGZVFWFLSA-N |
| InChICode |
InChI=1S/C21H22O6/c1-11(2)5-8-17(27-18(25)9-12(3)4)13-10-16(24)19-14(22)6-7-15(23)20(19)21(13)26/h5-7,9-10,17,22-23H,8H2,1-4H3/t17-/m1/s1 |
| SMILES |
CC(C)=CC[C@@H](OC(=O)C=C(C)C)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Arnebia euchroma  | Ref. |
| Plantae | Boraginaceae | Arnebia guttata  | Ref. |
| Plantae | Boraginaceae | Lithospermum erythrorhizon  | Ref. |
| Plantae | Boraginaceae | Lithospermum viridiflorum | Ref. |
| Plantae | Boraginaceae | Onosma paniculata | Ref. |
|
|
zoom in
| Organism | Lithospermum viridiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|