| Name |
2-methyl-1-propanol Isobutanol Isobutyl alcohol 1-Isobutanol |
| Formula |
C4H10O |
| Mw |
74.07316494 |
| CAS RN |
78-83-1 |
| C_ID |
C00050470
|
| InChIKey |
ZXEKIIBDNHEJCQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C4H10O/c1-4(2)3-5/h4-5H,3H2,1-2H3 |
| SMILES |
CC(C)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Malvaceae | Durio zibethinus  | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Tuber borchii  | Ref. |
| - | - | Tuber brumale  | Ref. |
| - | - | Tuber excavatum | Ref. |
| - | - | Tuber indicum  | Ref. |
| - | - | Tuber magnatum  | Ref. |
| - | - | Tuber melanosporum  | Ref. |
| - | - | Tuber mesentericum | Ref. |
| - | - | Tuber oligospermum  | Ref. |
| - | - | Tuber panniferum | Ref. |
| - | - | Tuber rufum  | Ref. |
| - | - | Tuber uncinatum | Ref. |
|
|
zoom in
| Organism | Cornus officinalis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|