| Name |
Pungenin |
| Formula |
C14H18O8 |
| Mw |
314.10016755 |
| CAS RN |
55483-00-6 |
| C_ID |
C00048073
, 
|
| InChIKey |
AOXMCWFZPZRDPE-UWSPHAEVNA-N |
| InChICode |
InChI=1S/C14H18O8/c1-6(16)7-2-3-8(17)9(4-7)21-14-13(20)12(19)11(18)10(5-15)22-14/h2-4,10-15,17-20H,5H2,1H3/t10-,11-,12+,13-,14-/m1/s1 |
| SMILES |
CC(=O)c1ccc(O)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Ficus septica | Ref. |
| Plantae | Plantaginaceae | Veronica catarractae | Ref. |
| Plantae | Plantaginaceae | Veronica derwentiana | Ref. |
| Plantae | Plantaginaceae | Veronica perfoliata | Ref. |
|
|
zoom in
| Organism | Veronica perfoliata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|