| Name |
Osmanthuside B (-)-Osmanthuside B |
| Formula |
C29H36O13 |
| Mw |
592.21559124 |
| CAS RN |
94492-23-6 |
| C_ID |
C00044985
, 
|
| InChIKey |
PRTREKIVGSNQRM-ITBLCBBWNA-N |
| InChICode |
InChI=1S/C29H36O13/c1-15-22(34)23(35)24(36)29(39-15)42-27-25(37)28(38-13-12-17-4-9-19(32)10-5-17)40-20(14-30)26(27)41-21(33)11-6-16-2-7-18(31)8-3-16/h2-11,15,20,22-32,34-37H,12-14H2,1H3/b11-6+/t15-,20+,22-,23+,24+,25+,26-,27+,28+,29-/m0/s1 |
| SMILES |
C[C@@H]1O[C@@H](O[C@H]2C(OC(=O)/C=C/c3ccc(O)cc3)[C@@H](CO)O[C@@H](OCCc3ccc(O)cc3)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Oleaceae | Ligustrum robustum | Ref. |
| Plantae | Oleaceae | Osmanthus fragrans  | Ref. |
| Plantae | Orobanchaceae | Cistanche deserticola  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
|
|
zoom in
| Organism | Scrophularia dentata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|