| Name |
Salaspermic acid |
| Formula |
C30H48O4 |
| Mw |
472.35526002 |
| CAS RN |
71247-78-4 |
| C_ID |
C00043883
, 
|
| InChIKey |
ZXENWDWQTWYUGY-XILUSGNANA-N |
| InChICode |
InChI=1S/C30H48O4/c1-19-29-9-7-20-26(4,21(29)8-10-30(19,33)34-18-29)14-16-28(6)22-17-25(3,23(31)32)12-11-24(22,2)13-15-27(20,28)5/h19-22,33H,7-18H2,1-6H3,(H,31,32)/t19-,20+,21+,22-,24+,25-,26-,27-,28+,29?,30+/m1/s1 |
| SMILES |
C[C@@H]1[C@@]23CC[C@H]4[C@@](C)(CC[C@@]5(C)[C@@H]6C[C@](C)(C(=O)O)CC[C@]6(C)CC[C@]45C)[C@@H]2CC[C@]1(O)OC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Celastraceae | Maytenus loevis | Ref. |
| Plantae | Celastraceae | Salacia macrosperma  | Ref. |
| Plantae | Celastraceae | Salacia prinoides | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
|
|
zoom in
| Organism | Tripterygium wilfordii | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chen, et al., JNP, 55, (1992), 340.
KISHI, et al., Chem Pharm Bull, 51, (2003), 1051 |
|---|
|