| Name |
Drummondol |
| Formula |
C13H20O4 |
| Mw |
240.13615913 |
| CAS RN |
77162-65-3 |
| C_ID |
C00043471
, 
|
| InChIKey |
KENVUEOHDFOVNA-QVWDAHOVNA-N |
| InChICode |
InChI=1S/C13H20O4/c1-9(14)4-5-13(16)11(2)6-10(15)7-12(13,3)17-8-11/h4-5,9,14,16H,6-8H2,1-3H3/b5-4+/t9-,11+,12+,13+/m0/s1 |
| SMILES |
CC(O)/C=C/C1(O)[C@@]2(C)CO[C@]1(C)CC(=O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Sesbania drummondii | Ref. |
| Plantae | Solanaceae | Capsicum annum | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum nigrum  | Ref. |
|
|
zoom in
| Organism | Solanum nigrum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|