| Name |
Harmol |
| Formula |
C12H10N2O |
| Mw |
198.07931296 |
| CAS RN |
487-03-6 |
| C_ID |
C00042574
, 
|
| InChIKey |
SATMZMMKDDTOSQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H10N2O/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12/h2-6,14-15H,1H3 |
| SMILES |
Cc1nccc2c1[nH]c1cc(O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cyperaceae | Carex brevicollis DC.  | Ref. |
| Plantae | Elaeagnaceae | Elaeagnus angustifolia  | Ref. |
| Plantae | Fontinalaceae | Fontinalis squamosa | Ref. |
| Plantae | Nitrariaceae | Peganum harmala  | Ref. |
| Plantae | Passifloraceae | Passiflora incarnata  | Ref. |
| Plantae | Rubiaceae | Psychotria viridis | Ref. |
|
|
zoom in
| Organism | Peganum harmala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|