| Name |
Toosendanin |
| Formula |
C30H38O11 |
| Mw |
574.24141206 |
| CAS RN |
58812-37-6 |
| C_ID |
C00040507
, 
|
| InChIKey |
NAHTXVIXCMUDLF-WWAUTWNBNA-N |
| InChICode |
InChI=1S/C30H38O11/c1-13(31)39-20-10-19(34)29-12-38-25(36)26(20,3)17(29)9-18(33)28(5)23(29)22(35)24(40-14(2)32)27(4)16(15-6-7-37-11-15)8-21-30(27,28)41-21/h6-7,11,16-21,23-25,33-34,36H,8-10,12H2,1-5H3/t16-,17?,18+,19-,20+,21+,23?,24-,25+,26+,27+,28+,29?,30-/m0/s1 |
| SMILES |
CC(=O)O[C@@H]1C[C@H](O)[C@@]23CO[C@@H](O)C1(C)[C@@H]2C[C@@H](O)[C@]1(C)[C@@H]3C(=O)[C@H](OC(C)=O)[C@@]2(C)[C@H](c3ccoc3)C[C@H]3O[C@]321 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Meliaceae | Melia azedarach  | Ref. |
| Plantae | Meliaceae | Melia toosendan Sieb.et Zuce.  | Ref. |
| Plantae | Meliaceae | Toona sinensis  | Ref. |
| Plantae | Turneraceae | Turnera ulmifolia  | Ref. |
|
|
zoom in
| Organism | Turnera ulmifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|