| Name |
Isoscopoletin |
| Formula |
C10H8O4 |
| Mw |
192.04225874 |
| CAS RN |
776-86-3 |
| C_ID |
C00039452
, 
|
| InChIKey |
SYTYLPHCLSSCOJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H8O4/c1-13-9-5-8-6(4-7(9)11)2-3-10(12)14-8/h2-5,11H,1H3 |
| SMILES |
COc1cc2oc(=O)ccc2cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea biebersteinii  | Ref. |
| Plantae | Asteraceae | Artemisia scoparia  | Ref. |
| Plantae | Buxaceae | Buxus microphylla var.sinica | Ref. |
| Plantae | Chloranthaceae | Chloranthus japonicus | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
|
|
zoom in
| Organism | Chloranthus japonicus | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Chandrasekharan, et al., Planta Med, 43, (1981), 310 |
|---|
|