| Name |
Isopolygodial (-)-Isopolygodial |
| Formula |
C15H22O2 |
| Mw |
234.16197995 |
| CAS RN |
5956-39-8 |
| C_ID |
C00039450
, 
|
| InChIKey |
AZJUJOFIHHNCSV-IGBQHBFGNA-N |
| InChICode |
InChI=1S/C15H22O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,9-10,12-13H,4,6-8H2,1-3H3/t12-,13+,15+/m1/s1 |
| SMILES |
CC1(C)CCC[C@]2(C)[C@H](C=O)C(C=O)=CC[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Canellaceae | Cinnamosma macrocarpa | Ref. |
| Plantae | Canellaceae | Warburgia salutaris  | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper  | Ref. |
|
|
zoom in
| Organism | Polygonum hydropiper | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|