| Name |
8-epi-Deoxyloganic acid 8-Epideoxyloganic acid Epideoxyloganic acid |
| Formula |
C16H24O9 |
| Mw |
360.14203237 |
| CAS RN |
88668-99-9 |
| C_ID |
C00036663
, 
|
| InChIKey |
DSXFHNSGLYXPNG-KYAHAFDNNA-N |
| InChICode |
InChI=1S/C16H24O9/c1-6-2-3-7-8(14(21)22)5-23-15(10(6)7)25-16-13(20)12(19)11(18)9(4-17)24-16/h5-7,9-13,15-20H,2-4H2,1H3,(H,21,22)/t6-,7-,9-,10-,11-,12+,13-,15+,16+/m1/s1 |
| SMILES |
C[C@@H]1CC[C@@H]2C(C(=O)O)=CO[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Bignoniaceae | Incarvillea delavayi | Ref. |
| Plantae | Plantaginaceae | Plantago webbii | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
|
|
zoom in
| Organism | Scrophularia dentata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|