| Name |
4-Isopropylbenzoic acid cumic acid |
| Formula |
C10H12O2 |
| Mw |
164.08372963 |
| CAS RN |
536-66-3 |
| C_ID |
C00036581
, 
|
| InChIKey |
CKMXAIVXVKGGFM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H12O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3,(H,11,12) |
| SMILES |
CC(C)c1ccc(C(=O)O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Cuminum cyminum  | Ref. |
| Plantae | Apiaceae | Ferula spp. | Ref. |
| Plantae | Cupressaceae | Libocedrus yateensis | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Phyllanthaceae | Bridelia retusa  | Ref. |
|
|
zoom in
| Organism | Perilla frutescens | | Reference | Aldrich Library of 13C and 1H FT NMR Spectra,2,(1992),1073C |
|---|
|