| Name |
Yunnanxane |
| Formula |
C31H46O9 |
| Mw |
562.31418307 |
| CAS RN |
139713-81-8 |
| C_ID |
C00036244
, 
|
| InChIKey |
FMPIEMVVEJGMCY-KAIOFLEMNA-N |
| InChICode |
InChI=1S/C31H46O9/c1-15-13-23(40-29(36)16(2)18(4)32)27-28(39-21(7)35)26-17(3)22(37-19(5)33)11-12-31(26,10)14-24(38-20(6)34)25(15)30(27,8)9/h16,18,22-24,26-28,32H,3,11-14H2,1-2,4-10H3/t16-,18+,22+,23+,24+,26+,27+,28+,31+/m1/s1 |
| SMILES |
C=C1[C@@H](OC(C)=O)CC[C@@]2(C)C[C@H](OC(C)=O)C3=C(C)C[C@H](OC(=O)[C@H](C)[C@H](C)O)[C@@H]([C@@H](OC(C)=O)[C@H]12)C3(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus cuspidata | Ref. |
| Plantae | Taxaceae | Taxus mairei | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Taxus mairei |
|---|
| Reference | Chen, et al., APS, 26, (1991), 747.
Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Shinozaki, et al., JNP, 65, (2002), 371 |
|---|
|
