| Name |
Oleanonic acid |
| Formula |
C30H46O3 |
| Mw |
454.34469533 |
| CAS RN |
17990-42-0 |
| C_ID |
C00035357
, 
|
| InChIKey |
FMIMFCRXYXVFTA-KTWXVQRFNA-N |
| InChICode |
InChI=1S/C30H46O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8,20-22H,9-18H2,1-7H3,(H,32,33)/t20-,21-,22+,27-,28+,29+,30-/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Meliaceae | Ekebergia pterophylla | Ref. |
| Plantae | Moraceae | Ficus microcarpa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Verbenaceae | Junellia tridens | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|