| Name |
Arjunglucoside I (+)-Arjunglucoside I |
| Formula |
C36H58O11 |
| Mw |
666.3979127 |
| CAS RN |
62319-70-4 |
| C_ID |
C00035052
, 
|
| InChIKey |
CMZFNIMQBCBHEX-HZTLGPLANA-N |
| InChICode |
InChI=1S/C36H58O11/c1-31(2)11-13-36(30(45)47-29-26(42)25(41)24(40)20(16-37)46-29)14-12-34(5)18(23(36)28(31)44)7-8-22-32(3)15-19(39)27(43)33(4,17-38)21(32)9-10-35(22,34)6/h7,19-29,37-44H,8-17H2,1-6H3/t19-,20-,21-,22-,23-,24-,25+,26-,27+,28+,29+,32+,33+,34-,35-,36+/m1/s1 |
| SMILES |
CC1(C)CC[C@]2(C(=O)OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)[C@@](C)(CO)[C@@H]5CC[C@]43C)[C@@H]2[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Combretaceae | Combretum quadrangulare  | Ref. |
| Plantae | Combretaceae | Pteleopsis suberosa Engl.et Diels  | Ref. |
| Plantae | Combretaceae | Terminalia arjuna  | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
| - | - | Rudgea viburnoides | Ref. |
|
|
zoom in
| Organism | Terminalia fagifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|