| Name |
3-Isomangostin 3-Isomangostin hydrate |
| Formula |
C24H26O6 |
| Mw |
410.17293856 |
| CAS RN |
19275-46-8 |
| C_ID |
C00034764
, 
|
| InChIKey |
KJCDBAVVDILRMP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C24H26O6/c1-12(2)6-7-14-19-17(10-15(25)23(14)28-5)29-18-11-16-13(8-9-24(3,4)30-16)21(26)20(18)22(19)27/h6,10-11,25-26H,7-9H2,1-5H3 |
| SMILES |
COc1c(O)cc2oc3cc4c(c(O)c3c(=O)c2c1CC=C(C)C)CCC(C)(C)O4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia nitida | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
|
|
zoom in
| Organism | Garcinia schomburgkiana | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|