| Name |
Retrofractamide A |
| Formula |
C20H25NO3 |
| Mw |
327.18344367 |
| CAS RN |
94079-67-1 |
| C_ID |
C00034654
, 
|
| InChIKey |
AHEYHYFMDFGWEG-HJHGIKLDNA-N |
| InChICode |
InChI=1S/C20H25NO3/c1-3-16(2)21-20(22)11-9-7-5-4-6-8-10-17-12-13-18-19(14-17)24-15-23-18/h5,7-14,16H,3-4,6,15H2,1-2H3,(H,21,22)/b7-5+,10-8+,11-9+/t16-/m1/s1 |
| SMILES |
CCC(C)NC(=O)/C=C/C=C/CC/C=C/c1ccc2c(c1)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Piperaceae | Piper longum  | Ref. |
| Plantae | Piperaceae | Piper manii | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Piperaceae | Piper rectrofractum | Ref. |
| Plantae | Piperaceae | Piper retrofractum  | Ref. |
| - | - | Javanese long pepper | Ref. |
|
|
zoom in
| Organism | Piper rectrofractum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|