| Name |
Hyperforin |
| Formula |
C35H52O4 |
| Mw |
536.38656015 |
| CAS RN |
11079-53-1 |
| C_ID |
C00034542
, 
|
| InChIKey |
IWBJJCOKGLUQIZ-GXUKJDDZNA-N |
| InChICode |
InChI=1S/C35H52O4/c1-22(2)13-12-19-33(11)27(16-14-23(3)4)21-34(20-18-25(7)8)30(37)28(17-15-24(5)6)31(38)35(33,32(34)39)29(36)26(9)10/h13-15,18,26-27,38H,12,16-17,19-21H2,1-11H3/t27-,33+,34+,35-/m0/s1 |
| SMILES |
CC(C)=CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@]2(CC=C(C)C)C(=O)C(CC=C(C)C)=C(O)[C@@]1(C(=O)C(C)C)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Hypericaceae | Hypericum ascyron  | Ref. |
| Plantae | Hypericaceae | Hypericum barbatum Jacq.  | Ref. |
| Plantae | Hypericaceae | Hypericum curvisepalum | Ref. |
| Plantae | Hypericaceae | Hypericum elodioides | Ref. |
| Plantae | Hypericaceae | Hypericum faberi | Ref. |
| Plantae | Hypericaceae | Hypericum hirsutum L. | Ref. |
| Plantae | Hypericaceae | Hypericum japonicum  | Ref. |
| Plantae | Hypericaceae | Hypericum lancasteri | Ref. |
| Plantae | Hypericaceae | Hypericum linarioides BOSSE | Ref. |
| Plantae | Hypericaceae | Hypericum maculatum Crantz  | Ref. |
| Plantae | Hypericaceae | Hypericum patulum | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum  | Ref. |
| Plantae | Hypericaceae | Hypericum rumeliacum BOISS. | Ref. |
| Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
| Plantae | Hypericaceae | Hypericum subsessile | Ref. |
| Plantae | Hypericaceae | Hypericum tetrapterum Fries  | Ref. |
| Plantae | Hypericaceae | Hypericum wightianum | Ref. |
|
|
zoom in
| Organism | Hypericum elodioides | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Shan, et al., Journal of Natural Products, 64, (2001), 127.
Wirz, et al., Phytochemistry, 55, (2000), 941.
Heilmann, et al., Planta Med, 69, (2003), 202.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|