| Name |
Periplocin |
| Formula |
C36H56O13 |
| Mw |
696.37209188 |
| CAS RN |
13137-64-9 |
| C_ID |
C00034109
, 
|
| InChIKey |
KWBPKUMWVXUSCA-RIEFTLBANA-N |
| InChICode |
InChI=1S/C36H56O13/c1-18-31(49-32-30(41)29(40)28(39)25(16-37)48-32)24(44-4)14-27(46-18)47-20-5-9-33(2)22-6-10-34(3)21(19-13-26(38)45-17-19)8-12-36(34,43)23(22)7-11-35(33,42)15-20/h13,18,20-25,27-32,37,39-43H,5-12,14-17H2,1-4H3/t18-,20+,21-,22+,23-,24+,25-,27+,28-,29+,30-,31-,32+,33-,34-,35+,36+/m1/s1 |
| SMILES |
CO[C@H]1C[C@H](O[C@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)C(C6=CC(=O)OC6)CC[C@]5(O)[C@@H]4CC[C@]3(O)C2)O[C@H](C)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Periploca forrestii Schltr. | Ref. |
| Plantae | Apocynaceae | Periploca graeca  | Ref. |
| Plantae | Apocynaceae | Periploca sepium Bge.  | Ref. |
| Plantae | Apocynaceae | Strophanthus kombe  | Ref. |
| Plantae | Apocynaceae | Strophanthus nicholsonii | Ref. |
|
|
zoom in
| Organism | Strophanthus kombe | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|