| Name |
Alpinoside (-)-Alpinoside |
| Formula |
C18H24O11 |
| Mw |
416.13186161 |
| CAS RN |
180028-16-4 |
| C_ID |
C00032701
, 
|
| InChIKey |
SBKHBPAOTDHFBN-FUGUWTAGNA-N |
| InChICode |
InChI=1S/C18H24O11/c1-7(20)26-5-8-2-3-9-10(16(24)25)6-27-17(12(8)9)29-18-15(23)14(22)13(21)11(4-19)28-18/h6,9,11,13-15,17-19,21-23H,2-5H2,1H3,(H,24,25)/t9-,11-,13-,14+,15-,17+,18+/m1/s1 |
| SMILES |
CC(=O)OCC1=C2[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C(C(=O)O)[C@H]2CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Globulariaceae | Globularia davisiana | Ref. |
| Plantae | Globulariaceae | Globularia trichosantha | Ref. |
| Plantae | Plantaginaceae | Plantago alpina | Ref. |
| Plantae | Plantaginaceae | Veronica beccabunga  | Ref. |
| Plantae | Plantaginaceae | Veronica cymbalaria | Ref. |
| Plantae | Rosaceae | Rubus ellipticus var.obcordatus  | Ref. |
|
|
zoom in
| Organism | Veronica beccabunga | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|