| Name |
Osthenol |
| Formula |
C14H14O3 |
| Mw |
230.09429431 |
| CAS RN |
484-14-0 |
| C_ID |
C00030900
, 
|
| InChIKey |
RAKJVIPCCGXHHS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H14O3/c1-9(2)3-6-11-12(15)7-4-10-5-8-13(16)17-14(10)11/h3-5,7-8,15H,6H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)ccc2ccc(=O)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica keiskei  | Ref. |
| Plantae | Apiaceae | Apium graveolens | Ref. |
| Plantae | Apiaceae | Heracleum candicans WALL. | Ref. |
| Plantae | Apiaceae | Notopterygium incisum | Ref. |
| Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
| Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
| Plantae | Rutaceae | Phellodendron amurense var.wilsonii | Ref. |
|
|
zoom in
| Organism | Notopterygium incisum |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Bandara, et al., Planta Med, 54, (1988), 374.
Wu, et al., JNP, 66, (2003), 1207.
Ito, et al., Planta Med, 71, (2005), 84 |
|---|
|
