| Name |
Notoginsenoside R4 (+)-Notoginsenoside R4 |
| Formula |
C59H100O27 |
| Mw |
1240.64519799 |
| CAS RN |
87741-77-3 |
| C_ID |
C00030858
, 
|
| InChIKey |
IWDYQBDCEDNTDP-HIUXJGFVNA-N |
| InChICode |
InChI=1S/C59H100O27/c1-24(2)10-9-14-59(8,86-53-48(76)43(71)40(68)31(83-53)23-79-51-46(74)42(70)39(67)30(82-51)22-78-50-45(73)36(64)27(63)21-77-50)25-11-16-58(7)35(25)26(62)18-33-56(5)15-13-34(55(3,4)32(56)12-17-57(33,58)6)84-54-49(44(72)38(66)29(20-61)81-54)85-52-47(75)41(69)37(65)28(19-60)80-52/h10,25-54,60-76H,9,11-23H2,1-8H3/t25-,26+,27-,28+,29+,30+,31+,32-,33+,34-,35-,36-,37+,38+,39+,40+,41-,42-,43-,44-,45-,46+,47+,48+,49+,50+,51+,52-,53+,54-,56-,57+,58+,59-/m0/s1 |
| SMILES |
CC(C)=CCC[C@](C)(OC1O[C@H](CO[C@@H]2O[C@H](CO[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O)[C@H]1CC[C@]2(C)[C@@H]1[C@H](O)C[C@@H]1[C@@]3(C)CC[C@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C(C)(C)[C@@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Araliaceae | Panax japonicus  | Ref. |
| Plantae | Araliaceae | Panax notoginseng  | Ref. |
| Plantae | Araliaceae | Panax pseudo-ginseng var.japonicus  | Ref. |
| Plantae | Araliaceae | Panax pseudo-ginseng var.notoginseng  | Ref. |
|
|
zoom in
| Organism | Panax pseudo-ginseng var.japonicus | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Zou, et al., JNP, 65, (2002), 1288 |
|---|
|