| Name |
Methyl indole-3-carboxylate |
| Formula |
C10H9NO2 |
| Mw |
175.06332854 |
| CAS RN |
942-24-5 |
| C_ID |
C00030756
, 
|
| InChIKey |
QXAUTQFAWKKNLM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H9NO2/c1-13-10(12)8-6-11-9-5-3-2-4-7(8)9/h2-6,11H,1H3 |
| SMILES |
COC(=O)c1c[nH]c2ccccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ligularia dentata Hara | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
|
|
zoom in
| Organism | Abutilon indicum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|