| Name |
Icariside B2
(-)-Icariside B2 |
| Formula |
C19H30O8 |
| Mw |
386.19406794 |
| CAS RN |
108906-51-0 |
| C_ID |
C00030506
, 
|
| InChIKey |
RZPOXAOUEYNXNO-ZAHLALJQNA-N |
| InChICode |
InChI=1S/C19H30O8/c1-10(21)5-6-19-17(2,3)7-11(8-18(19,4)27-19)25-16-15(24)14(23)13(22)12(9-20)26-16/h5-6,11-16,20,22-24H,7-9H2,1-4H3/b6-5+/t11-,12+,13+,14-,15+,16+,18+,19-/m0/s1 |
| SMILES |
CC(=O)/C=C/[C@@]12O[C@]1(C)C[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CC2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Coriandrum sativum  | Ref. |
| Plantae | Apiaceae | Pimpinella anisum L. | Ref. |
| Plantae | Berberidaceae | Epimedium grandiflorum var. grandiflorum | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum | Ref. |
| Plantae | Euphorbiaceae | Euphorbia helioscopia L. | Ref. |
| Plantae | Labiatae | Nepeta cadmea | Ref. |
| Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
| Plantae | Staphyleaceae | Staphylea bumalda DC. | Ref. |
| Plantae | Vitaceae | Vitis vinifera | Ref. |
| - | - | Scurrura atropurpurea | Ref. |
|
|
zoom in
| Organism | Epimedium sagittatum |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
