| Name |
Norhygrine N-Demethylhygrine |
| Formula |
C17H13NO |
| Mw |
247.09971404 |
| CAS RN |
130325-43-8 |
| C_ID |
C00028721
, 
|
| InChIKey |
ZAJDAGLJUKMNJL-JLDDOWRYNA-N |
| InChICode |
InChI=1S/C7H13NO/c1-6(9)5-7-3-2-4-8-7/h7-8H,2-5H2,1H3/t7-/m1/s1 |
| SMILES |
CC(=O)C[C@H]1CCCN1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Solanaceae | Hyoscyamus albus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| Plantae | Solanaceae | Nierembergia hippomanica | Ref. |
|
|
zoom in
| Organism | Hyoscyamus desertorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|